mirror of
https://git.libcamera.org/libcamera/libcamera.git
synced 2025-07-24 09:05:06 +03:00
ipa: ipu3: set frameContext before controls
The AGC frame context needs to be initialised correctly for the first iteration. Until now, the IPA uses the minimum exposure and gain values and caches those in local variables. In order to give the sensor limits to AGC, create a new structure in IPASessionConfiguration. Store the exposure in time (and not line duration) and the analogue gain after CameraSensorHelper conversion. Set the gain and exposure appropriately to the current values known to the IPA and remove the setting of exposure and gain in IPAIPU3 as those are now fully controlled by IPU3Agc. Signed-off-by: Jean-Michel Hautbois <jeanmichel.hautbois@ideasonboard.com> Reviewed-by: Kieran Bingham <kieran.bingham@ideasonboard.com> Reviewed-by: Laurent Pinchart <laurent.pinchart@ideasonboard.com>
This commit is contained in:
parent
59687683a1
commit
7c9c1a2a92
3 changed files with 73 additions and 8 deletions
|
@ -60,7 +60,13 @@ int Agc::configure(IPAContext &context, const IPAConfigInfo &configInfo)
|
|||
|
||||
lineDuration_ = configInfo.sensorInfo.lineLength * 1.0s
|
||||
/ configInfo.sensorInfo.pixelRate;
|
||||
maxExposureTime_ = kMaxExposure * lineDuration_;
|
||||
maxExposureTime_ = context.configuration.agc.maxShutterSpeed;
|
||||
|
||||
/* Configure the default exposure and gain. */
|
||||
context.frameContext.agc.gain =
|
||||
context.configuration.agc.minAnalogueGain;
|
||||
context.frameContext.agc.exposure =
|
||||
context.configuration.agc.minShutterSpeed / lineDuration_;
|
||||
|
||||
return 0;
|
||||
}
|
||||
|
|
|
@ -10,6 +10,8 @@
|
|||
|
||||
#include <linux/intel-ipu3.h>
|
||||
|
||||
#include <libcamera/base/utils.h>
|
||||
|
||||
#include <libcamera/geometry.h>
|
||||
|
||||
namespace libcamera {
|
||||
|
@ -22,6 +24,13 @@ struct IPASessionConfiguration {
|
|||
Size bdsOutputSize;
|
||||
uint32_t stride;
|
||||
} grid;
|
||||
|
||||
struct {
|
||||
utils::Duration minShutterSpeed;
|
||||
utils::Duration maxShutterSpeed;
|
||||
double minAnalogueGain;
|
||||
double maxAnalogueGain;
|
||||
} agc;
|
||||
};
|
||||
|
||||
struct IPAFrameContext {
|
||||
|
|
|
@ -97,6 +97,23 @@
|
|||
* \brief Number of cells on one line including the ImgU padding
|
||||
*/
|
||||
|
||||
/**
|
||||
* \struct IPASessionConfiguration::agc
|
||||
* \brief AGC parameters configuration of the IPA
|
||||
*
|
||||
* \var IPASessionConfiguration::agc::minShutterSpeed
|
||||
* \brief Minimum shutter speed supported with the configured sensor
|
||||
*
|
||||
* \var IPASessionConfiguration::grid::maxShutterSpeed
|
||||
* \brief Maximum shutter speed supported with the configured sensor
|
||||
*
|
||||
* \var IPASessionConfiguration::grid::minAnalogueGain
|
||||
* \brief Minimum analogue gain supported with the configured sensor
|
||||
*
|
||||
* \var IPASessionConfiguration::grid::maxAnalogueGain
|
||||
* \brief Maximum analogue gain supported with the configured sensor
|
||||
*/
|
||||
|
||||
/**
|
||||
* \struct IPAFrameContext::agc
|
||||
* \brief Context for the Automatic Gain Control algorithm
|
||||
|
@ -158,6 +175,8 @@ namespace libcamera {
|
|||
|
||||
LOG_DEFINE_CATEGORY(IPAIPU3)
|
||||
|
||||
using namespace std::literals::chrono_literals;
|
||||
|
||||
namespace ipa::ipu3 {
|
||||
|
||||
class IPAIPU3 : public IPAIPU3Interface
|
||||
|
@ -182,6 +201,8 @@ private:
|
|||
void updateControls(const IPACameraSensorInfo &sensorInfo,
|
||||
const ControlInfoMap &sensorControls,
|
||||
ControlInfoMap *ipaControls);
|
||||
void updateSessionConfiguration(const IPACameraSensorInfo &sensorInfo,
|
||||
const ControlInfoMap &sensorControls);
|
||||
void processControls(unsigned int frame, const ControlList &controls);
|
||||
void fillParams(unsigned int frame, ipu3_uapi_params *params);
|
||||
void parseStatistics(unsigned int frame,
|
||||
|
@ -216,6 +237,36 @@ private:
|
|||
struct IPAContext context_;
|
||||
};
|
||||
|
||||
/*
|
||||
* Compute IPASessionConfiguration using the sensor information and the sensor
|
||||
* v4l2 controls.
|
||||
*/
|
||||
void IPAIPU3::updateSessionConfiguration(const IPACameraSensorInfo &sensorInfo,
|
||||
const ControlInfoMap &sensorControls)
|
||||
{
|
||||
const ControlInfo &v4l2Exposure = sensorControls.find(V4L2_CID_EXPOSURE)->second;
|
||||
int32_t minExposure = v4l2Exposure.min().get<int32_t>();
|
||||
int32_t maxExposure = v4l2Exposure.max().get<int32_t>();
|
||||
|
||||
utils::Duration lineDuration = sensorInfo.lineLength * 1.0s
|
||||
/ sensorInfo.pixelRate;
|
||||
|
||||
const ControlInfo &v4l2Gain = sensorControls.find(V4L2_CID_ANALOGUE_GAIN)->second;
|
||||
int32_t minGain = v4l2Gain.min().get<int32_t>();
|
||||
int32_t maxGain = v4l2Gain.max().get<int32_t>();
|
||||
|
||||
/*
|
||||
* When the AGC computes the new exposure values for a frame, it needs
|
||||
* to know the limits for shutter speed and analogue gain.
|
||||
* As it depends on the sensor, update it with the controls.
|
||||
*
|
||||
* \todo take VBLANK into account for maximum shutter speed
|
||||
*/
|
||||
context_.configuration.agc.minShutterSpeed = minExposure * lineDuration;
|
||||
context_.configuration.agc.maxShutterSpeed = maxExposure * lineDuration;
|
||||
context_.configuration.agc.minAnalogueGain = camHelper_->gain(minGain);
|
||||
context_.configuration.agc.maxAnalogueGain = camHelper_->gain(maxGain);
|
||||
}
|
||||
|
||||
/*
|
||||
* Compute camera controls using the sensor information and the sensor
|
||||
|
@ -436,15 +487,18 @@ int IPAIPU3::configure(const IPAConfigInfo &configInfo,
|
|||
|
||||
calculateBdsGrid(configInfo.bdsOutputSize);
|
||||
|
||||
/* Update the camera controls using the new sensor settings. */
|
||||
updateControls(sensorInfo_, ctrls_, ipaControls);
|
||||
|
||||
/* Update the IPASessionConfiguration using the sensor settings. */
|
||||
updateSessionConfiguration(sensorInfo_, ctrls_);
|
||||
|
||||
for (auto const &algo : algorithms_) {
|
||||
int ret = algo->configure(context_, configInfo);
|
||||
if (ret)
|
||||
return ret;
|
||||
}
|
||||
|
||||
/* Update the camera controls using the new sensor settings. */
|
||||
updateControls(sensorInfo_, ctrls_, ipaControls);
|
||||
|
||||
return 0;
|
||||
}
|
||||
|
||||
|
@ -543,10 +597,6 @@ void IPAIPU3::parseStatistics(unsigned int frame,
|
|||
{
|
||||
ControlList ctrls(controls::controls);
|
||||
|
||||
/* \todo These fields should not be written by the IPAIPU3 layer */
|
||||
context_.frameContext.agc.gain = camHelper_->gain(gain_);
|
||||
context_.frameContext.agc.exposure = exposure_;
|
||||
|
||||
for (auto const &algo : algorithms_)
|
||||
algo->process(context_, stats);
|
||||
|
||||
|
|
Loading…
Add table
Add a link
Reference in a new issue