mirror of
https://git.libcamera.org/libcamera/libcamera.git
synced 2025-07-23 16:45:07 +03:00
NaNs can appear if no black dots can be found and analysed in a particular region of the calibration image. There needs to be at least one such dot in every 8x8 cell covering the image. This is now detected, and an error message issued. No CAC tables are generated, so CAC is disabled. Bug: https://github.com/raspberrypi/libcamera/issues/254 Signed-off-by: David Plowman <david.plowman@raspberrypi.com> Reviewed-by: Naushir Patuck <naush@raspberrypi.com> Acked-by: Kieran Bingham <kieran.bingham@ideasonboard.com> Signed-off-by: Kieran Bingham <kieran.bingham@ideasonboard.com>
250 lines
12 KiB
Python
250 lines
12 KiB
Python
# SPDX-License-Identifier: BSD-2-Clause
|
|
#
|
|
# Copyright (C) 2023, Raspberry Pi Ltd
|
|
#
|
|
# ctt_cac.py - CAC (Chromatic Aberration Correction) tuning tool
|
|
|
|
from PIL import Image
|
|
import numpy as np
|
|
import matplotlib.pyplot as plt
|
|
from matplotlib import cm
|
|
|
|
from ctt_dots_locator import find_dots_locations
|
|
|
|
|
|
# This is the wrapper file that creates a JSON entry for you to append
|
|
# to your camera tuning file.
|
|
# It calculates the chromatic aberration at different points throughout
|
|
# the image and uses that to produce a martix that can then be used
|
|
# in the camera tuning files to correct this aberration.
|
|
|
|
|
|
def pprint_array(array):
|
|
# Function to print the array in a tidier format
|
|
array = array
|
|
output = ""
|
|
for i in range(len(array)):
|
|
for j in range(len(array[0])):
|
|
output += str(round(array[i, j], 2)) + ", "
|
|
# Add the necessary indentation to the array
|
|
output += "\n "
|
|
# Cut off the end of the array (nicely formats it)
|
|
return output[:-22]
|
|
|
|
|
|
def plot_shifts(red_shifts, blue_shifts):
|
|
# If users want, they can pass a command line option to show the shifts on a graph
|
|
# Can be useful to check that the functions are all working, and that the sample
|
|
# images are doing the right thing
|
|
Xs = np.array(red_shifts)[:, 0]
|
|
Ys = np.array(red_shifts)[:, 1]
|
|
Zs = np.array(red_shifts)[:, 2]
|
|
Zs2 = np.array(red_shifts)[:, 3]
|
|
Zs3 = np.array(blue_shifts)[:, 2]
|
|
Zs4 = np.array(blue_shifts)[:, 3]
|
|
|
|
fig, axs = plt.subplots(2, 2)
|
|
ax = fig.add_subplot(2, 2, 1, projection='3d')
|
|
ax.scatter(Xs, Ys, Zs, cmap=cm.jet, linewidth=0)
|
|
ax.set_title('Red X Shift')
|
|
ax = fig.add_subplot(2, 2, 2, projection='3d')
|
|
ax.scatter(Xs, Ys, Zs2, cmap=cm.jet, linewidth=0)
|
|
ax.set_title('Red Y Shift')
|
|
ax = fig.add_subplot(2, 2, 3, projection='3d')
|
|
ax.scatter(Xs, Ys, Zs3, cmap=cm.jet, linewidth=0)
|
|
ax.set_title('Blue X Shift')
|
|
ax = fig.add_subplot(2, 2, 4, projection='3d')
|
|
ax.scatter(Xs, Ys, Zs4, cmap=cm.jet, linewidth=0)
|
|
ax.set_title('Blue Y Shift')
|
|
fig.tight_layout()
|
|
plt.show()
|
|
|
|
|
|
def shifts_to_yaml(red_shift, blue_shift, image_dimensions, output_grid_size=9):
|
|
# Convert the shifts to a numpy array for easier handling and initialise other variables
|
|
red_shifts = np.array(red_shift)
|
|
blue_shifts = np.array(blue_shift)
|
|
# create a grid that's smaller than the output grid, which we then interpolate from to get the output values
|
|
xrgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))
|
|
xbgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))
|
|
yrgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))
|
|
ybgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))
|
|
|
|
xrsgrid = []
|
|
xbsgrid = []
|
|
yrsgrid = []
|
|
ybsgrid = []
|
|
xg = np.zeros((output_grid_size - 1, output_grid_size - 1))
|
|
yg = np.zeros((output_grid_size - 1, output_grid_size - 1))
|
|
|
|
# Format the grids - numpy doesn't work for this, it wants a
|
|
# nice uniformly spaced grid, which we don't know if we have yet, hence the rather mundane setup
|
|
for x in range(output_grid_size - 1):
|
|
xrsgrid.append([])
|
|
yrsgrid.append([])
|
|
xbsgrid.append([])
|
|
ybsgrid.append([])
|
|
for y in range(output_grid_size - 1):
|
|
xrsgrid[x].append([])
|
|
yrsgrid[x].append([])
|
|
xbsgrid[x].append([])
|
|
ybsgrid[x].append([])
|
|
|
|
image_size = (image_dimensions[0], image_dimensions[1])
|
|
gridxsize = image_size[0] / (output_grid_size - 1)
|
|
gridysize = image_size[1] / (output_grid_size - 1)
|
|
|
|
# Iterate through each dot, and it's shift values and put these into the correct grid location
|
|
for red_shift in red_shifts:
|
|
xgridloc = int(red_shift[0] / gridxsize)
|
|
ygridloc = int(red_shift[1] / gridysize)
|
|
xrsgrid[xgridloc][ygridloc].append(red_shift[2])
|
|
yrsgrid[xgridloc][ygridloc].append(red_shift[3])
|
|
|
|
for blue_shift in blue_shifts:
|
|
xgridloc = int(blue_shift[0] / gridxsize)
|
|
ygridloc = int(blue_shift[1] / gridysize)
|
|
xbsgrid[xgridloc][ygridloc].append(blue_shift[2])
|
|
ybsgrid[xgridloc][ygridloc].append(blue_shift[3])
|
|
|
|
# Now calculate the average pixel shift for each square in the grid
|
|
grid_incomplete = False
|
|
for x in range(output_grid_size - 1):
|
|
for y in range(output_grid_size - 1):
|
|
if xrsgrid[x][y]:
|
|
xrgrid[x, y] = np.mean(xrsgrid[x][y])
|
|
else:
|
|
grid_incomplete = True
|
|
if yrsgrid[x][y]:
|
|
yrgrid[x, y] = np.mean(yrsgrid[x][y])
|
|
else:
|
|
grid_incomplete = True
|
|
if xbsgrid[x][y]:
|
|
xbgrid[x, y] = np.mean(xbsgrid[x][y])
|
|
else:
|
|
grid_incomplete = True
|
|
if ybsgrid[x][y]:
|
|
ybgrid[x, y] = np.mean(ybsgrid[x][y])
|
|
else:
|
|
grid_incomplete = True
|
|
|
|
if grid_incomplete:
|
|
raise RuntimeError("\nERROR: CAC measurements do not span the image!"
|
|
"\nConsider using improved CAC images, or remove them entirely.\n")
|
|
|
|
# Next, we start to interpolate the central points of the grid that gets passed to the tuning file
|
|
input_grids = np.array([xrgrid, yrgrid, xbgrid, ybgrid])
|
|
output_grids = np.zeros((4, output_grid_size, output_grid_size))
|
|
|
|
# Interpolate the centre of the grid
|
|
output_grids[:, 1:-1, 1:-1] = (input_grids[:, 1:, :-1] + input_grids[:, 1:, 1:] + input_grids[:, :-1, 1:] + input_grids[:, :-1, :-1]) / 4
|
|
|
|
# Edge cases:
|
|
output_grids[:, 1:-1, 0] = ((input_grids[:, :-1, 0] + input_grids[:, 1:, 0]) / 2 - output_grids[:, 1:-1, 1]) * 2 + output_grids[:, 1:-1, 1]
|
|
output_grids[:, 1:-1, -1] = ((input_grids[:, :-1, 7] + input_grids[:, 1:, 7]) / 2 - output_grids[:, 1:-1, -2]) * 2 + output_grids[:, 1:-1, -2]
|
|
output_grids[:, 0, 1:-1] = ((input_grids[:, 0, :-1] + input_grids[:, 0, 1:]) / 2 - output_grids[:, 1, 1:-1]) * 2 + output_grids[:, 1, 1:-1]
|
|
output_grids[:, -1, 1:-1] = ((input_grids[:, 7, :-1] + input_grids[:, 7, 1:]) / 2 - output_grids[:, -2, 1:-1]) * 2 + output_grids[:, -2, 1:-1]
|
|
|
|
# Corner Cases:
|
|
output_grids[:, 0, 0] = (output_grids[:, 0, 1] - output_grids[:, 1, 1]) + (output_grids[:, 1, 0] - output_grids[:, 1, 1]) + output_grids[:, 1, 1]
|
|
output_grids[:, 0, -1] = (output_grids[:, 0, -2] - output_grids[:, 1, -2]) + (output_grids[:, 1, -1] - output_grids[:, 1, -2]) + output_grids[:, 1, -2]
|
|
output_grids[:, -1, 0] = (output_grids[:, -1, 1] - output_grids[:, -2, 1]) + (output_grids[:, -2, 0] - output_grids[:, -2, 1]) + output_grids[:, -2, 1]
|
|
output_grids[:, -1, -1] = (output_grids[:, -2, -1] - output_grids[:, -2, -2]) + (output_grids[:, -1, -2] - output_grids[:, -2, -2]) + output_grids[:, -2, -2]
|
|
|
|
# Below, we swap the x and the y coordinates, and also multiply by a factor of -1
|
|
# This is due to the PiSP (standard) dimensions being flipped in comparison to
|
|
# PIL image coordinate directions, hence why xr -> yr. Also, the shifts calculated are colour shifts,
|
|
# and the PiSP block asks for the values it should shift by (hence the * -1, to convert from colour shift to a pixel shift)
|
|
|
|
output_grid_yr, output_grid_xr, output_grid_yb, output_grid_xb = output_grids * -1
|
|
return output_grid_xr, output_grid_yr, output_grid_xb, output_grid_yb
|
|
|
|
|
|
def analyse_dot(dot, dot_location=[0, 0]):
|
|
# Scan through the dot, calculate the centroid of each colour channel by doing:
|
|
# pixel channel brightness * distance from top left corner
|
|
# Sum these, and divide by the sum of each channel's brightnesses to get a centroid for each channel
|
|
red_channel = np.array(dot)[:, :, 0]
|
|
y_num_pixels = len(red_channel[0])
|
|
x_num_pixels = len(red_channel)
|
|
yred_weight = np.sum(np.dot(red_channel, np.arange(y_num_pixels)))
|
|
xred_weight = np.sum(np.dot(np.arange(x_num_pixels), red_channel))
|
|
red_sum = np.sum(red_channel)
|
|
|
|
green_channel = np.array(dot)[:, :, 1]
|
|
ygreen_weight = np.sum(np.dot(green_channel, np.arange(y_num_pixels)))
|
|
xgreen_weight = np.sum(np.dot(np.arange(x_num_pixels), green_channel))
|
|
green_sum = np.sum(green_channel)
|
|
|
|
blue_channel = np.array(dot)[:, :, 2]
|
|
yblue_weight = np.sum(np.dot(blue_channel, np.arange(y_num_pixels)))
|
|
xblue_weight = np.sum(np.dot(np.arange(x_num_pixels), blue_channel))
|
|
blue_sum = np.sum(blue_channel)
|
|
|
|
# We return this structure. It contains 2 arrays that contain:
|
|
# the locations of the dot center, along with the channel shifts in the x and y direction:
|
|
# [ [red_center_x, red_center_y, red_x_shift, red_y_shift], [blue_center_x, blue_center_y, blue_x_shift, blue_y_shift] ]
|
|
|
|
return [[int(dot_location[0]) + int(len(dot) / 2), int(dot_location[1]) + int(len(dot[0]) / 2), xred_weight / red_sum - xgreen_weight / green_sum, yred_weight / red_sum - ygreen_weight / green_sum], [dot_location[0] + int(len(dot) / 2), dot_location[1] + int(len(dot[0]) / 2), xblue_weight / blue_sum - xgreen_weight / green_sum, yblue_weight / blue_sum - ygreen_weight / green_sum]]
|
|
|
|
|
|
def cac(Cam):
|
|
filelist = Cam.imgs_cac
|
|
|
|
Cam.log += '\nCAC analysing files: {}'.format(str(filelist))
|
|
np.set_printoptions(precision=3)
|
|
np.set_printoptions(suppress=True)
|
|
|
|
# Create arrays to hold all the dots data and their colour offsets
|
|
red_shift = [] # Format is: [[Dot Center X, Dot Center Y, x shift, y shift]]
|
|
blue_shift = []
|
|
# Iterate through the files
|
|
# Multiple files is reccomended to average out the lens aberration through rotations
|
|
for file in filelist:
|
|
Cam.log += '\nCAC processing file'
|
|
print("\n Processing file")
|
|
# Read the raw RGB values
|
|
rgb = file.rgb
|
|
image_size = [file.h, file.w] # Image size, X, Y
|
|
# Create a colour copy of the RGB values to use later in the calibration
|
|
imout = Image.new(mode="RGB", size=image_size)
|
|
rgb_image = np.array(imout)
|
|
# The rgb values need reshaping from a 1d array to a 3d array to be worked with easily
|
|
rgb.reshape((image_size[0], image_size[1], 3))
|
|
rgb_image = rgb
|
|
|
|
# Pass the RGB image through to the dots locating program
|
|
# Returns an array of the dots (colour rectangles around the dots), and an array of their locations
|
|
print("Finding dots")
|
|
Cam.log += '\nFinding dots'
|
|
dots, dots_locations = find_dots_locations(rgb_image)
|
|
|
|
# Now, analyse each dot. Work out the centroid of each colour channel, and use that to work out
|
|
# by how far the chromatic aberration has shifted each channel
|
|
Cam.log += '\nDots found: {}'.format(str(len(dots)))
|
|
print('Dots found: ' + str(len(dots)))
|
|
|
|
for dot, dot_location in zip(dots, dots_locations):
|
|
if len(dot) > 0:
|
|
if (dot_location[0] > 0) and (dot_location[1] > 0):
|
|
ret = analyse_dot(dot, dot_location)
|
|
red_shift.append(ret[0])
|
|
blue_shift.append(ret[1])
|
|
|
|
# Take our arrays of red shifts and locations, push them through to be interpolated into a 9x9 matrix
|
|
# for the CAC block to handle and then store these as a .json file to be added to the camera
|
|
# tuning file
|
|
print("\nCreating output grid")
|
|
Cam.log += '\nCreating output grid'
|
|
try:
|
|
rx, ry, bx, by = shifts_to_yaml(red_shift, blue_shift, image_size)
|
|
except RuntimeError as e:
|
|
print(str(e))
|
|
Cam.log += "\nCAC correction failed! CAC will not be enabled."
|
|
return {}
|
|
|
|
print("CAC correction complete!")
|
|
Cam.log += '\nCAC correction complete!'
|
|
|
|
# Give the JSON dict back to the main ctt program
|
|
return {"strength": 1.0, "lut_rx": list(rx.round(2).reshape(81)), "lut_ry": list(ry.round(2).reshape(81)), "lut_bx": list(bx.round(2).reshape(81)), "lut_by": list(by.round(2).reshape(81))}
|