mirror of
https://git.libcamera.org/libcamera/libcamera.git
synced 2025-07-23 08:35:07 +03:00
Added the ability to tune the chromatic aberration correction within the ctt. There are options for cac_only or to tune as part of a larger tuning process. CTT will now recognise any files that begin with "cac" as being chromatic aberration tuning files. Signed-off-by: Ben Benson <ben.benson@raspberrypi.com> Signed-off-by: David Plowman <david.plowman@raspberrypi.com> Reviewed-by: Naushir Patuck <naush@raspberrypi.com> Tested-by: Naushir Patuck <naush@raspberrypi.com> Acked-by: Kieran Bingham <kieran.bingham@ideasonboard.com> Signed-off-by: Kieran Bingham <kieran.bingham@ideasonboard.com>
228 lines
11 KiB
Python
228 lines
11 KiB
Python
# SPDX-License-Identifier: BSD-2-Clause
|
|
#
|
|
# Copyright (C) 2023, Raspberry Pi Ltd
|
|
#
|
|
# ctt_cac.py - CAC (Chromatic Aberration Correction) tuning tool
|
|
|
|
from PIL import Image
|
|
import numpy as np
|
|
import matplotlib.pyplot as plt
|
|
from matplotlib import cm
|
|
|
|
from ctt_dots_locator import find_dots_locations
|
|
|
|
|
|
# This is the wrapper file that creates a JSON entry for you to append
|
|
# to your camera tuning file.
|
|
# It calculates the chromatic aberration at different points throughout
|
|
# the image and uses that to produce a martix that can then be used
|
|
# in the camera tuning files to correct this aberration.
|
|
|
|
|
|
def pprint_array(array):
|
|
# Function to print the array in a tidier format
|
|
array = array
|
|
output = ""
|
|
for i in range(len(array)):
|
|
for j in range(len(array[0])):
|
|
output += str(round(array[i, j], 2)) + ", "
|
|
# Add the necessary indentation to the array
|
|
output += "\n "
|
|
# Cut off the end of the array (nicely formats it)
|
|
return output[:-22]
|
|
|
|
|
|
def plot_shifts(red_shifts, blue_shifts):
|
|
# If users want, they can pass a command line option to show the shifts on a graph
|
|
# Can be useful to check that the functions are all working, and that the sample
|
|
# images are doing the right thing
|
|
Xs = np.array(red_shifts)[:, 0]
|
|
Ys = np.array(red_shifts)[:, 1]
|
|
Zs = np.array(red_shifts)[:, 2]
|
|
Zs2 = np.array(red_shifts)[:, 3]
|
|
Zs3 = np.array(blue_shifts)[:, 2]
|
|
Zs4 = np.array(blue_shifts)[:, 3]
|
|
|
|
fig, axs = plt.subplots(2, 2)
|
|
ax = fig.add_subplot(2, 2, 1, projection='3d')
|
|
ax.scatter(Xs, Ys, Zs, cmap=cm.jet, linewidth=0)
|
|
ax.set_title('Red X Shift')
|
|
ax = fig.add_subplot(2, 2, 2, projection='3d')
|
|
ax.scatter(Xs, Ys, Zs2, cmap=cm.jet, linewidth=0)
|
|
ax.set_title('Red Y Shift')
|
|
ax = fig.add_subplot(2, 2, 3, projection='3d')
|
|
ax.scatter(Xs, Ys, Zs3, cmap=cm.jet, linewidth=0)
|
|
ax.set_title('Blue X Shift')
|
|
ax = fig.add_subplot(2, 2, 4, projection='3d')
|
|
ax.scatter(Xs, Ys, Zs4, cmap=cm.jet, linewidth=0)
|
|
ax.set_title('Blue Y Shift')
|
|
fig.tight_layout()
|
|
plt.show()
|
|
|
|
|
|
def shifts_to_yaml(red_shift, blue_shift, image_dimensions, output_grid_size=9):
|
|
# Convert the shifts to a numpy array for easier handling and initialise other variables
|
|
red_shifts = np.array(red_shift)
|
|
blue_shifts = np.array(blue_shift)
|
|
# create a grid that's smaller than the output grid, which we then interpolate from to get the output values
|
|
xrgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))
|
|
xbgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))
|
|
yrgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))
|
|
ybgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))
|
|
|
|
xrsgrid = []
|
|
xbsgrid = []
|
|
yrsgrid = []
|
|
ybsgrid = []
|
|
xg = np.zeros((output_grid_size - 1, output_grid_size - 1))
|
|
yg = np.zeros((output_grid_size - 1, output_grid_size - 1))
|
|
|
|
# Format the grids - numpy doesn't work for this, it wants a
|
|
# nice uniformly spaced grid, which we don't know if we have yet, hence the rather mundane setup
|
|
for x in range(output_grid_size - 1):
|
|
xrsgrid.append([])
|
|
yrsgrid.append([])
|
|
xbsgrid.append([])
|
|
ybsgrid.append([])
|
|
for y in range(output_grid_size - 1):
|
|
xrsgrid[x].append([])
|
|
yrsgrid[x].append([])
|
|
xbsgrid[x].append([])
|
|
ybsgrid[x].append([])
|
|
|
|
image_size = (image_dimensions[0], image_dimensions[1])
|
|
gridxsize = image_size[0] / (output_grid_size - 1)
|
|
gridysize = image_size[1] / (output_grid_size - 1)
|
|
|
|
# Iterate through each dot, and it's shift values and put these into the correct grid location
|
|
for red_shift in red_shifts:
|
|
xgridloc = int(red_shift[0] / gridxsize)
|
|
ygridloc = int(red_shift[1] / gridysize)
|
|
xrsgrid[xgridloc][ygridloc].append(red_shift[2])
|
|
yrsgrid[xgridloc][ygridloc].append(red_shift[3])
|
|
|
|
for blue_shift in blue_shifts:
|
|
xgridloc = int(blue_shift[0] / gridxsize)
|
|
ygridloc = int(blue_shift[1] / gridysize)
|
|
xbsgrid[xgridloc][ygridloc].append(blue_shift[2])
|
|
ybsgrid[xgridloc][ygridloc].append(blue_shift[3])
|
|
|
|
# Now calculate the average pixel shift for each square in the grid
|
|
for x in range(output_grid_size - 1):
|
|
for y in range(output_grid_size - 1):
|
|
xrgrid[x, y] = np.mean(xrsgrid[x][y])
|
|
yrgrid[x, y] = np.mean(yrsgrid[x][y])
|
|
xbgrid[x, y] = np.mean(xbsgrid[x][y])
|
|
ybgrid[x, y] = np.mean(ybsgrid[x][y])
|
|
|
|
# Next, we start to interpolate the central points of the grid that gets passed to the tuning file
|
|
input_grids = np.array([xrgrid, yrgrid, xbgrid, ybgrid])
|
|
output_grids = np.zeros((4, output_grid_size, output_grid_size))
|
|
|
|
# Interpolate the centre of the grid
|
|
output_grids[:, 1:-1, 1:-1] = (input_grids[:, 1:, :-1] + input_grids[:, 1:, 1:] + input_grids[:, :-1, 1:] + input_grids[:, :-1, :-1]) / 4
|
|
|
|
# Edge cases:
|
|
output_grids[:, 1:-1, 0] = ((input_grids[:, :-1, 0] + input_grids[:, 1:, 0]) / 2 - output_grids[:, 1:-1, 1]) * 2 + output_grids[:, 1:-1, 1]
|
|
output_grids[:, 1:-1, -1] = ((input_grids[:, :-1, 7] + input_grids[:, 1:, 7]) / 2 - output_grids[:, 1:-1, -2]) * 2 + output_grids[:, 1:-1, -2]
|
|
output_grids[:, 0, 1:-1] = ((input_grids[:, 0, :-1] + input_grids[:, 0, 1:]) / 2 - output_grids[:, 1, 1:-1]) * 2 + output_grids[:, 1, 1:-1]
|
|
output_grids[:, -1, 1:-1] = ((input_grids[:, 7, :-1] + input_grids[:, 7, 1:]) / 2 - output_grids[:, -2, 1:-1]) * 2 + output_grids[:, -2, 1:-1]
|
|
|
|
# Corner Cases:
|
|
output_grids[:, 0, 0] = (output_grids[:, 0, 1] - output_grids[:, 1, 1]) + (output_grids[:, 1, 0] - output_grids[:, 1, 1]) + output_grids[:, 1, 1]
|
|
output_grids[:, 0, -1] = (output_grids[:, 0, -2] - output_grids[:, 1, -2]) + (output_grids[:, 1, -1] - output_grids[:, 1, -2]) + output_grids[:, 1, -2]
|
|
output_grids[:, -1, 0] = (output_grids[:, -1, 1] - output_grids[:, -2, 1]) + (output_grids[:, -2, 0] - output_grids[:, -2, 1]) + output_grids[:, -2, 1]
|
|
output_grids[:, -1, -1] = (output_grids[:, -2, -1] - output_grids[:, -2, -2]) + (output_grids[:, -1, -2] - output_grids[:, -2, -2]) + output_grids[:, -2, -2]
|
|
|
|
# Below, we swap the x and the y coordinates, and also multiply by a factor of -1
|
|
# This is due to the PiSP (standard) dimensions being flipped in comparison to
|
|
# PIL image coordinate directions, hence why xr -> yr. Also, the shifts calculated are colour shifts,
|
|
# and the PiSP block asks for the values it should shift by (hence the * -1, to convert from colour shift to a pixel shift)
|
|
|
|
output_grid_yr, output_grid_xr, output_grid_yb, output_grid_xb = output_grids * -1
|
|
return output_grid_xr, output_grid_yr, output_grid_xb, output_grid_yb
|
|
|
|
|
|
def analyse_dot(dot, dot_location=[0, 0]):
|
|
# Scan through the dot, calculate the centroid of each colour channel by doing:
|
|
# pixel channel brightness * distance from top left corner
|
|
# Sum these, and divide by the sum of each channel's brightnesses to get a centroid for each channel
|
|
red_channel = np.array(dot)[:, :, 0]
|
|
y_num_pixels = len(red_channel[0])
|
|
x_num_pixels = len(red_channel)
|
|
yred_weight = np.sum(np.dot(red_channel, np.arange(y_num_pixels)))
|
|
xred_weight = np.sum(np.dot(np.arange(x_num_pixels), red_channel))
|
|
red_sum = np.sum(red_channel)
|
|
|
|
green_channel = np.array(dot)[:, :, 1]
|
|
ygreen_weight = np.sum(np.dot(green_channel, np.arange(y_num_pixels)))
|
|
xgreen_weight = np.sum(np.dot(np.arange(x_num_pixels), green_channel))
|
|
green_sum = np.sum(green_channel)
|
|
|
|
blue_channel = np.array(dot)[:, :, 2]
|
|
yblue_weight = np.sum(np.dot(blue_channel, np.arange(y_num_pixels)))
|
|
xblue_weight = np.sum(np.dot(np.arange(x_num_pixels), blue_channel))
|
|
blue_sum = np.sum(blue_channel)
|
|
|
|
# We return this structure. It contains 2 arrays that contain:
|
|
# the locations of the dot center, along with the channel shifts in the x and y direction:
|
|
# [ [red_center_x, red_center_y, red_x_shift, red_y_shift], [blue_center_x, blue_center_y, blue_x_shift, blue_y_shift] ]
|
|
|
|
return [[int(dot_location[0]) + int(len(dot) / 2), int(dot_location[1]) + int(len(dot[0]) / 2), xred_weight / red_sum - xgreen_weight / green_sum, yred_weight / red_sum - ygreen_weight / green_sum], [dot_location[0] + int(len(dot) / 2), dot_location[1] + int(len(dot[0]) / 2), xblue_weight / blue_sum - xgreen_weight / green_sum, yblue_weight / blue_sum - ygreen_weight / green_sum]]
|
|
|
|
|
|
def cac(Cam):
|
|
filelist = Cam.imgs_cac
|
|
|
|
Cam.log += '\nCAC analysing files: {}'.format(str(filelist))
|
|
np.set_printoptions(precision=3)
|
|
np.set_printoptions(suppress=True)
|
|
|
|
# Create arrays to hold all the dots data and their colour offsets
|
|
red_shift = [] # Format is: [[Dot Center X, Dot Center Y, x shift, y shift]]
|
|
blue_shift = []
|
|
# Iterate through the files
|
|
# Multiple files is reccomended to average out the lens aberration through rotations
|
|
for file in filelist:
|
|
Cam.log += '\nCAC processing file'
|
|
print("\n Processing file")
|
|
# Read the raw RGB values
|
|
rgb = file.rgb
|
|
image_size = [file.h, file.w] # Image size, X, Y
|
|
# Create a colour copy of the RGB values to use later in the calibration
|
|
imout = Image.new(mode="RGB", size=image_size)
|
|
rgb_image = np.array(imout)
|
|
# The rgb values need reshaping from a 1d array to a 3d array to be worked with easily
|
|
rgb.reshape((image_size[0], image_size[1], 3))
|
|
rgb_image = rgb
|
|
|
|
# Pass the RGB image through to the dots locating program
|
|
# Returns an array of the dots (colour rectangles around the dots), and an array of their locations
|
|
print("Finding dots")
|
|
Cam.log += '\nFinding dots'
|
|
dots, dots_locations = find_dots_locations(rgb_image)
|
|
|
|
# Now, analyse each dot. Work out the centroid of each colour channel, and use that to work out
|
|
# by how far the chromatic aberration has shifted each channel
|
|
Cam.log += '\nDots found: {}'.format(str(len(dots)))
|
|
print('Dots found: ' + str(len(dots)))
|
|
|
|
for dot, dot_location in zip(dots, dots_locations):
|
|
if len(dot) > 0:
|
|
if (dot_location[0] > 0) and (dot_location[1] > 0):
|
|
ret = analyse_dot(dot, dot_location)
|
|
red_shift.append(ret[0])
|
|
blue_shift.append(ret[1])
|
|
|
|
# Take our arrays of red shifts and locations, push them through to be interpolated into a 9x9 matrix
|
|
# for the CAC block to handle and then store these as a .json file to be added to the camera
|
|
# tuning file
|
|
print("\nCreating output grid")
|
|
Cam.log += '\nCreating output grid'
|
|
rx, ry, bx, by = shifts_to_yaml(red_shift, blue_shift, image_size)
|
|
|
|
print("CAC correction complete!")
|
|
Cam.log += '\nCAC correction complete!'
|
|
|
|
# Give the JSON dict back to the main ctt program
|
|
return {"strength": 1.0, "lut_rx": list(rx.round(2).reshape(81)), "lut_ry": list(ry.round(2).reshape(81)), "lut_bx": list(bx.round(2).reshape(81)), "lut_by": list(by.round(2).reshape(81))}
|